C23H48O2Si2 — CID 11603993
tert-butyl-dimethyl-[(3S,4R,5S,7R)-3,5,7-trimethyl-8-triethylsilyloxyoct-1-yn-4-yl]oxysilane (PubChem CID 11603993) has the molecular formula C23H48O2Si2 and a molecular weight of 412.81 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3S,4R,5S,7R)-3,5,7-trimethyl-8-triethylsilyloxyoct-1-yn-4-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3S,4R,5S,7R)-3,5,7-trimethyl-8-triethylsilyloxyoct-1-yn-4-yl]oxysilane |
|---|---|
| PubChem CID | 11603993 |
| Molecular Formula | C23H48O2Si2 |
| Molecular Weight | 412.81 g/mol |
| Exact Mass | 412.32 |
| IUPAC Name | tert-butyl-dimethyl-[(3S,4R,5S,7R)-3,5,7-trimethyl-8-triethylsilyloxyoct-1-yn-4-yl]oxysilane |
| SMILES | C#C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C[C@@H](C)CO[Si](CC)(CC)CC |
| InChI | InChI=1S/C23H48O2Si2/c1-13-20(6)22(25-26(11,12)23(8,9)10)21(7)17-19(5)18-24-27(14-2,15-3)16-4/h1,19-22H,14-18H2,2-12H3/t19-,20+,21+,22+/m1/s1 |
| InChIKey | XJVGQYBFHKDKFD-MLNNCEHLSA-N |
| XLogP | 7.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.81 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|