C26H50O2Si2 — CID 134977488
triethyl-[(4R,5R,7S,8R)-4,6,8-trimethyl-7-triethylsilyloxyundeca-2,9-diyn-5-yl]oxysilane (PubChem CID 134977488) has the molecular formula C26H50O2Si2 and a molecular weight of 450.86 g/mol. Its IUPAC name is triethyl-[(4R,5R,7S,8R)-4,6,8-trimethyl-7-triethylsilyloxyundeca-2,9-diyn-5-yl]oxysilane.
| Compound Name | triethyl-[(4R,5R,7S,8R)-4,6,8-trimethyl-7-triethylsilyloxyundeca-2,9-diyn-5-yl]oxysilane |
|---|---|
| PubChem CID | 134977488 |
| Molecular Formula | C26H50O2Si2 |
| Molecular Weight | 450.86 g/mol |
| Exact Mass | 450.33 |
| IUPAC Name | triethyl-[(4R,5R,7S,8R)-4,6,8-trimethyl-7-triethylsilyloxyundeca-2,9-diyn-5-yl]oxysilane |
| SMILES | CC#C[C@@H](C)[C@H](O[Si](CC)(CC)CC)C(C)[C@H](O[Si](CC)(CC)CC)[C@H](C)C#CC |
| InChI | InChI=1S/C26H50O2Si2/c1-12-20-22(9)25(27-29(14-3,15-4)16-5)24(11)26(23(10)21-13-2)28-30(17-6,18-7)19-8/h22-26H,14-19H2,1-11H3/t22-,23-,24?,25-,26+/m1/s1 |
| InChIKey | DWPGIHDQVFRUHN-UKOCARPNSA-N |
| XLogP | 7.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.86 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|