C24H46O2Si2 — CID 11384680
triethyl-[(3R,4R,6S,7R)-3,5,7-trimethyl-6-triethylsilyloxynona-1,8-diyn-4-yl]oxysilane (PubChem CID 11384680) has the molecular formula C24H46O2Si2 and a molecular weight of 422.80 g/mol. Its IUPAC name is triethyl-[(3R,4R,6S,7R)-3,5,7-trimethyl-6-triethylsilyloxynona-1,8-diyn-4-yl]oxysilane.
| Compound Name | triethyl-[(3R,4R,6S,7R)-3,5,7-trimethyl-6-triethylsilyloxynona-1,8-diyn-4-yl]oxysilane |
|---|---|
| PubChem CID | 11384680 |
| Molecular Formula | C24H46O2Si2 |
| Molecular Weight | 422.80 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | triethyl-[(3R,4R,6S,7R)-3,5,7-trimethyl-6-triethylsilyloxynona-1,8-diyn-4-yl]oxysilane |
| SMILES | C#C[C@@H](C)[C@H](O[Si](CC)(CC)CC)C(C)[C@H](O[Si](CC)(CC)CC)[C@H](C)C#C |
| InChI | InChI=1S/C24H46O2Si2/c1-12-20(9)23(25-27(14-3,15-4)16-5)22(11)24(21(10)13-2)26-28(17-6,18-7)19-8/h1-2,20-24H,14-19H2,3-11H3/t20-,21-,22?,23-,24+/m1/s1 |
| InChIKey | KOHWAAKSONYTDB-OBAUXHOFSA-N |
| XLogP | 6.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.80 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|