C18H34O2Si2 — CID 134846317
[(1R,3S,4R)-3-dimethylsilyloxy-2,4-dimethyl-1-[(2R)-pent-3-yn-2-yl]hept-5-ynoxy]-dimethylsilane (PubChem CID 134846317) has the molecular formula C18H34O2Si2 and a molecular weight of 338.64 g/mol. Its IUPAC name is [(1R,3S,4R)-3-dimethylsilyloxy-2,4-dimethyl-1-[(2R)-pent-3-yn-2-yl]hept-5-ynoxy]-dimethylsilane.
| Compound Name | [(1R,3S,4R)-3-dimethylsilyloxy-2,4-dimethyl-1-[(2R)-pent-3-yn-2-yl]hept-5-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134846317 |
| Molecular Formula | C18H34O2Si2 |
| Molecular Weight | 338.64 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | [(1R,3S,4R)-3-dimethylsilyloxy-2,4-dimethyl-1-[(2R)-pent-3-yn-2-yl]hept-5-ynoxy]-dimethylsilane |
| SMILES | CC#C[C@@H](C)[C@H](O[SiH](C)C)C(C)[C@H](O[SiH](C)C)[C@H](C)C#CC |
| InChI | InChI=1S/C18H34O2Si2/c1-10-12-14(3)17(19-21(6)7)16(5)18(20-22(8)9)15(4)13-11-2/h14-18,21-22H,1-9H3/t14-,15-,16?,17-,18+/m1/s1 |
| InChIKey | NYJDKDDYWIFAHA-VUCRHFMTSA-N |
| XLogP | 3.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.64 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|