C17H36OSi2 — CID 135078090
tert-butyl-dimethyl-[(2R,3S)-3-methyl-7-trimethylsilylhept-6-yn-2-yl]oxysilane (PubChem CID 135078090) has the molecular formula C17H36OSi2 and a molecular weight of 312.65 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2R,3S)-3-methyl-7-trimethylsilylhept-6-yn-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2R,3S)-3-methyl-7-trimethylsilylhept-6-yn-2-yl]oxysilane |
|---|---|
| PubChem CID | 135078090 |
| Molecular Formula | C17H36OSi2 |
| Molecular Weight | 312.65 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | tert-butyl-dimethyl-[(2R,3S)-3-methyl-7-trimethylsilylhept-6-yn-2-yl]oxysilane |
| SMILES | C[C@@H](CCC#C[Si](C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H36OSi2/c1-15(13-11-12-14-19(6,7)8)16(2)18-20(9,10)17(3,4)5/h15-16H,11,13H2,1-10H3/t15-,16+/m0/s1 |
| InChIKey | VLJQQHWGUHYUPC-JKSUJKDBSA-N |
| XLogP | 5.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.65 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|