C29H56OSi — CID 531320
2,6-dimethylnon-1-en-3-yn-5-yloxy(trihexyl)silane (PubChem CID 531320) has the molecular formula C29H56OSi and a molecular weight of 448.85 g/mol. Its IUPAC name is 2,6-dimethylnon-1-en-3-yn-5-yloxy(trihexyl)silane.
| Compound Name | 2,6-dimethylnon-1-en-3-yn-5-yloxy(trihexyl)silane |
|---|---|
| PubChem CID | 531320 |
| Molecular Formula | C29H56OSi |
| Molecular Weight | 448.85 g/mol |
| Exact Mass | 448.41 |
| IUPAC Name | 2,6-dimethylnon-1-en-3-yn-5-yloxy(trihexyl)silane |
| SMILES | C=C(C)C#CC(O[Si](CCCCCC)(CCCCCC)CCCCCC)C(C)CCC |
| InChI | InChI=1S/C29H56OSi/c1-8-12-15-18-24-31(25-19-16-13-9-2,26-20-17-14-10-3)30-29(23-22-27(5)6)28(7)21-11-4/h28-29H,5,8-21,24-26H2,1-4,6-7H3 |
| InChIKey | AKBFPQKMMCFOSC-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.85 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|