C22H46O2Si2 — CID 53329373
tert-butyl-[(5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methylnon-8-ynoxy]-dimethylsilane (PubChem CID 53329373) has the molecular formula C22H46O2Si2 and a molecular weight of 398.78 g/mol. Its IUPAC name is tert-butyl-[(5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methylnon-8-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methylnon-8-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 53329373 |
| Molecular Formula | C22H46O2Si2 |
| Molecular Weight | 398.78 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | tert-butyl-[(5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methylnon-8-ynoxy]-dimethylsilane |
| SMILES | C#CC[C@H](C)[C@H](CCCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H46O2Si2/c1-13-16-19(2)20(24-26(11,12)22(6,7)8)17-14-15-18-23-25(9,10)21(3,4)5/h1,19-20H,14-18H2,2-12H3/t19-,20-/m0/s1 |
| InChIKey | CUMIGQWSFXQMIM-PMACEKPBSA-N |
| XLogP | 7.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.78 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|