C25H50O4Si2 — CID 10552336
[(4R,5S,8S)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-4,8-dimethylnon-2-ynyl] acetate (PubChem CID 10552336) has the molecular formula C25H50O4Si2 and a molecular weight of 470.84 g/mol. Its IUPAC name is [(4R,5S,8S)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-4,8-dimethylnon-2-ynyl] acetate.
| Compound Name | [(4R,5S,8S)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-4,8-dimethylnon-2-ynyl] acetate |
|---|---|
| PubChem CID | 10552336 |
| Molecular Formula | C25H50O4Si2 |
| Molecular Weight | 470.84 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | [(4R,5S,8S)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-4,8-dimethylnon-2-ynyl] acetate |
| SMILES | CC(=O)OCC#C[C@@H](C)[C@H](CC[C@H](C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H50O4Si2/c1-20(19-28-30(10,11)24(4,5)6)16-17-23(29-31(12,13)25(7,8)9)21(2)15-14-18-27-22(3)26/h20-21,23H,16-19H2,1-13H3/t20-,21+,23-/m0/s1 |
| InChIKey | FSGOWDGHUNYKQI-XJUOHMSHSA-N |
| XLogP | 7.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.84 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|