C17H36O3Si — CID 11381522
[(3R,4S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylheptan-3-yl] acetate (PubChem CID 11381522) has the molecular formula C17H36O3Si and a molecular weight of 316.56 g/mol. Its IUPAC name is [(3R,4S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylheptan-3-yl] acetate.
| Compound Name | [(3R,4S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylheptan-3-yl] acetate |
|---|---|
| PubChem CID | 11381522 |
| Molecular Formula | C17H36O3Si |
| Molecular Weight | 316.56 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | [(3R,4S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylheptan-3-yl] acetate |
| SMILES | CC[C@@H](OC(C)=O)[C@@H](C)C[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H36O3Si/c1-10-16(20-15(4)18)14(3)11-13(2)12-19-21(8,9)17(5,6)7/h13-14,16H,10-12H2,1-9H3/t13-,14+,16-/m1/s1 |
| InChIKey | PNHLLDFKZODSCA-IJEWVQPXSA-N |
| XLogP | 5.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|