C21H44O4Si — CID 89353450
[(3R,4R,5S,6S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4,6,8-tetramethylnonan-3-yl] acetate (PubChem CID 89353450) has the molecular formula C21H44O4Si and a molecular weight of 388.67 g/mol. Its IUPAC name is [(3R,4R,5S,6S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4,6,8-tetramethylnonan-3-yl] acetate.
| Compound Name | [(3R,4R,5S,6S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4,6,8-tetramethylnonan-3-yl] acetate |
|---|---|
| PubChem CID | 89353450 |
| Molecular Formula | C21H44O4Si |
| Molecular Weight | 388.67 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | [(3R,4R,5S,6S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4,6,8-tetramethylnonan-3-yl] acetate |
| SMILES | CC(=O)O[C@H](C(C)C)[C@H](C)[C@H](O)[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C21H44O4Si/c1-13(2)19(24-17(7)22)15(5)18(23)16(6)20(14(3)4)25-26(11,12)21(8,9)10/h13-16,18-20,23H,1-12H3/t15-,16+,18+,19-,20-/m1/s1 |
| InChIKey | RWUZUZCWJYLPNA-MEBIHWHUSA-N |
| XLogP | 5.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.67 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|