C21H40O4Si — CID 11257624
[(4R,5R,6R,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,6,8-trimethyldec-2-ynyl] acetate (PubChem CID 11257624) has the molecular formula C21H40O4Si and a molecular weight of 384.63 g/mol. Its IUPAC name is [(4R,5R,6R,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,6,8-trimethyldec-2-ynyl] acetate.
| Compound Name | [(4R,5R,6R,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,6,8-trimethyldec-2-ynyl] acetate |
|---|---|
| PubChem CID | 11257624 |
| Molecular Formula | C21H40O4Si |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | [(4R,5R,6R,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,6,8-trimethyldec-2-ynyl] acetate |
| SMILES | CC[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](O)[C@H](C)C#CCOC(C)=O |
| InChI | InChI=1S/C21H40O4Si/c1-11-15(2)20(25-26(9,10)21(6,7)8)17(4)19(23)16(3)13-12-14-24-18(5)22/h15-17,19-20,23H,11,14H2,1-10H3/t15-,16+,17+,19+,20+/m0/s1 |
| InChIKey | DIZQYTRFQWSRKL-AZNNDXHDSA-N |
| XLogP | 4.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|