C19H36O4Si — CID 10546209
[(4R,5S,8S)-9-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,8-dimethylnon-2-ynyl] acetate (PubChem CID 10546209) has the molecular formula C19H36O4Si and a molecular weight of 356.58 g/mol. Its IUPAC name is [(4R,5S,8S)-9-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,8-dimethylnon-2-ynyl] acetate.
| Compound Name | [(4R,5S,8S)-9-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,8-dimethylnon-2-ynyl] acetate |
|---|---|
| PubChem CID | 10546209 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | [(4R,5S,8S)-9-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,8-dimethylnon-2-ynyl] acetate |
| SMILES | CC(=O)OCC#C[C@@H](C)[C@@H](O)CC[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O4Si/c1-15(14-23-24(7,8)19(4,5)6)11-12-18(21)16(2)10-9-13-22-17(3)20/h15-16,18,21H,11-14H2,1-8H3/t15-,16+,18-/m0/s1 |
| InChIKey | JCTWHVVHLWWMQW-JZXOWHBKSA-N |
| XLogP | 3.99 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|