C30H44O4Si2 — CID 11168444
[(4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[tert-butyl(diphenyl)silyl]oxyhex-2-ynyl] acetate (PubChem CID 11168444) has the molecular formula C30H44O4Si2 and a molecular weight of 524.85 g/mol. Its IUPAC name is [(4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[tert-butyl(diphenyl)silyl]oxyhex-2-ynyl] acetate.
| Compound Name | [(4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[tert-butyl(diphenyl)silyl]oxyhex-2-ynyl] acetate |
|---|---|
| PubChem CID | 11168444 |
| Molecular Formula | C30H44O4Si2 |
| Molecular Weight | 524.85 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | [(4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[tert-butyl(diphenyl)silyl]oxyhex-2-ynyl] acetate |
| SMILES | CC(=O)OCC#C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H44O4Si2/c1-24(33-35(9,10)29(3,4)5)28(22-17-23-32-25(2)31)34-36(30(6,7)8,26-18-13-11-14-19-26)27-20-15-12-16-21-27/h11-16,18-21,24,28H,23H2,1-10H3/t24-,28-/m0/s1 |
| InChIKey | KGNKUILAWNCDQH-CUBQBAPOSA-N |
| XLogP | 5.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.85 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|