C20H36O4Si2 — CID 15174206
(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[dimethyl(phenyl)silyl]-2-(methoxymethoxy)butan-1-one (PubChem CID 15174206) has the molecular formula C20H36O4Si2 and a molecular weight of 396.68 g/mol. Its IUPAC name is (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[dimethyl(phenyl)silyl]-2-(methoxymethoxy)butan-1-one.
| Compound Name | (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[dimethyl(phenyl)silyl]-2-(methoxymethoxy)butan-1-one |
|---|---|
| PubChem CID | 15174206 |
| Molecular Formula | C20H36O4Si2 |
| Molecular Weight | 396.68 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[dimethyl(phenyl)silyl]-2-(methoxymethoxy)butan-1-one |
| SMILES | COCO[C@H](C(=O)[Si](C)(C)c1ccccc1)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H36O4Si2/c1-16(24-26(8,9)20(2,3)4)18(23-15-22-5)19(21)25(6,7)17-13-11-10-12-14-17/h10-14,16,18H,15H2,1-9H3/t16-,18+/m1/s1 |
| InChIKey | SPUXVIWNNUDZKM-AEFFLSMTSA-N |
| XLogP | 4.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.68 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|