C21H38O2Si2 — CID 134950604
(E,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-[dimethyl(phenyl)silyl]-4-methylhex-2-en-1-ol (PubChem CID 134950604) has the molecular formula C21H38O2Si2 and a molecular weight of 378.71 g/mol. Its IUPAC name is (E,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-[dimethyl(phenyl)silyl]-4-methylhex-2-en-1-ol.
| Compound Name | (E,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-[dimethyl(phenyl)silyl]-4-methylhex-2-en-1-ol |
|---|---|
| PubChem CID | 134950604 |
| Molecular Formula | C21H38O2Si2 |
| Molecular Weight | 378.71 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (E,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-[dimethyl(phenyl)silyl]-4-methylhex-2-en-1-ol |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C(\CO)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C21H38O2Si2/c1-17(18(2)23-25(8,9)21(3,4)5)15-20(16-22)24(6,7)19-13-11-10-12-14-19/h10-15,17-18,22H,16H2,1-9H3/b20-15+/t17-,18-/m0/s1 |
| InChIKey | VVNYABPPWTUBFL-IUXPWNOESA-N |
| XLogP | 5.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.71 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|