C33H44O7Si2 — CID 10996578
[(Z,2S,5R,6R)-2,6-diacetyloxy-5-[tert-butyl(diphenyl)silyl]oxy-8-trimethylsilyloct-3-en-7-ynyl] acetate (PubChem CID 10996578) has the molecular formula C33H44O7Si2 and a molecular weight of 608.88 g/mol. Its IUPAC name is [(Z,2S,5R,6R)-2,6-diacetyloxy-5-[tert-butyl(diphenyl)silyl]oxy-8-trimethylsilyloct-3-en-7-ynyl] acetate.
| Compound Name | [(Z,2S,5R,6R)-2,6-diacetyloxy-5-[tert-butyl(diphenyl)silyl]oxy-8-trimethylsilyloct-3-en-7-ynyl] acetate |
|---|---|
| PubChem CID | 10996578 |
| Molecular Formula | C33H44O7Si2 |
| Molecular Weight | 608.88 g/mol |
| Exact Mass | 608.26 |
| IUPAC Name | [(Z,2S,5R,6R)-2,6-diacetyloxy-5-[tert-butyl(diphenyl)silyl]oxy-8-trimethylsilyloct-3-en-7-ynyl] acetate |
| SMILES | CC(=O)OC[C@H](/C=C\[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C#C[Si](C)(C)C)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C33H44O7Si2/c1-25(34)37-24-28(38-26(2)35)20-21-32(31(39-27(3)36)22-23-41(7,8)9)40-42(33(4,5)6,29-16-12-10-13-17-29)30-18-14-11-15-19-30/h10-21,28,31-32H,24H2,1-9H3/b21-20-/t28-,31+,32+/m0/s1 |
| InChIKey | UFWMWTGHPGAEGM-LKJXFVNVSA-N |
| XLogP | 4.80 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.88 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|