C27H34O6Si — CID 10073991
[(2R)-2-acetyloxy-2-[(2S,3R,5S)-2-[tert-butyl(diphenyl)silyl]-2,5-dimethyl-1,4-dioxaspiro[2.2]pentan-5-yl]ethyl] acetate (PubChem CID 10073991) has the molecular formula C27H34O6Si and a molecular weight of 482.65 g/mol. Its IUPAC name is [(2R)-2-acetyloxy-2-[(2S,3R,5S)-2-[tert-butyl(diphenyl)silyl]-2,5-dimethyl-1,4-dioxaspiro[2.2]pentan-5-yl]ethyl] acetate.
| Compound Name | [(2R)-2-acetyloxy-2-[(2S,3R,5S)-2-[tert-butyl(diphenyl)silyl]-2,5-dimethyl-1,4-dioxaspiro[2.2]pentan-5-yl]ethyl] acetate |
|---|---|
| PubChem CID | 10073991 |
| Molecular Formula | C27H34O6Si |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | [(2R)-2-acetyloxy-2-[(2S,3R,5S)-2-[tert-butyl(diphenyl)silyl]-2,5-dimethyl-1,4-dioxaspiro[2.2]pentan-5-yl]ethyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@]1(C)O[C@@]12O[C@@]2(C)[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H34O6Si/c1-19(28)30-18-23(31-20(2)29)25(6)27(32-25)26(7,33-27)34(24(3,4)5,21-14-10-8-11-15-21)22-16-12-9-13-17-22/h8-17,23H,18H2,1-7H3/t23-,25+,26+,27-/m1/s1 |
| InChIKey | VIRYTPRPPCHOHO-GYUKIKGESA-N |
| XLogP | 3.36 |
| TPSA | 77.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|