C29H62O5Si2 — CID 58822515
[3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-9-hydroxy-2,4,6,8-tetramethyldecyl] propanoate (PubChem CID 58822515) has the molecular formula C29H62O5Si2 and a molecular weight of 546.98 g/mol. Its IUPAC name is [3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-9-hydroxy-2,4,6,8-tetramethyldecyl] propanoate.
| Compound Name | [3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-9-hydroxy-2,4,6,8-tetramethyldecyl] propanoate |
|---|---|
| PubChem CID | 58822515 |
| Molecular Formula | C29H62O5Si2 |
| Molecular Weight | 546.98 g/mol |
| Exact Mass | 546.41 |
| IUPAC Name | [3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-9-hydroxy-2,4,6,8-tetramethyldecyl] propanoate |
| SMILES | CCC(=O)OCC(C)C(O[Si](C)(C)C(C)(C)C)C(C)CC(C)C(O[Si](C)(C)C(C)(C)C)C(C)C(C)O |
| InChI | InChI=1S/C29H62O5Si2/c1-17-25(31)32-19-22(4)26(33-35(13,14)28(7,8)9)20(2)18-21(3)27(23(5)24(6)30)34-36(15,16)29(10,11)12/h20-24,26-27,30H,17-19H2,1-16H3 |
| InChIKey | ZJOFXEIXJIHJNG-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.98 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|