C31H62O5Si2 — CID 11226891
[(4S,5R,7R,8S,9R)-5-hydroxy-4,8,10-trimethyl-7,9-bis(triethylsilyloxy)undec-2-ynyl] 2,2-dimethylpropanoate (PubChem CID 11226891) has the molecular formula C31H62O5Si2 and a molecular weight of 571.00 g/mol. Its IUPAC name is [(4S,5R,7R,8S,9R)-5-hydroxy-4,8,10-trimethyl-7,9-bis(triethylsilyloxy)undec-2-ynyl] 2,2-dimethylpropanoate.
| Compound Name | [(4S,5R,7R,8S,9R)-5-hydroxy-4,8,10-trimethyl-7,9-bis(triethylsilyloxy)undec-2-ynyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11226891 |
| Molecular Formula | C31H62O5Si2 |
| Molecular Weight | 571.00 g/mol |
| Exact Mass | 570.41 |
| IUPAC Name | [(4S,5R,7R,8S,9R)-5-hydroxy-4,8,10-trimethyl-7,9-bis(triethylsilyloxy)undec-2-ynyl] 2,2-dimethylpropanoate |
| SMILES | CC[Si](CC)(CC)O[C@H](C(C)C)[C@@H](C)[C@@H](C[C@@H](O)[C@@H](C)C#CCOC(=O)C(C)(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C31H62O5Si2/c1-14-37(15-2,16-3)35-28(26(10)29(24(7)8)36-38(17-4,18-5)19-6)23-27(32)25(9)21-20-22-34-30(33)31(11,12)13/h24-29,32H,14-19,22-23H2,1-13H3/t25-,26-,27+,28+,29+/m0/s1 |
| InChIKey | SXIZDVPOEBLDMA-MUPNWXRXSA-N |
| XLogP | 8.04 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.00 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|