C32H64O4Si2 — CID 10940780
[(2R,3R,4S,5S,6R)-3,5-bis[[diethyl(propan-2-yl)silyl]oxy]-4-ethyl-2,6-dimethylnon-8-ynyl] 2,2-dimethylpropanoate (PubChem CID 10940780) has the molecular formula C32H64O4Si2 and a molecular weight of 569.03 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3,5-bis[[diethyl(propan-2-yl)silyl]oxy]-4-ethyl-2,6-dimethylnon-8-ynyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4S,5S,6R)-3,5-bis[[diethyl(propan-2-yl)silyl]oxy]-4-ethyl-2,6-dimethylnon-8-ynyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10940780 |
| Molecular Formula | C32H64O4Si2 |
| Molecular Weight | 569.03 g/mol |
| Exact Mass | 568.43 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3,5-bis[[diethyl(propan-2-yl)silyl]oxy]-4-ethyl-2,6-dimethylnon-8-ynyl] 2,2-dimethylpropanoate |
| SMILES | C#CC[C@@H](C)[C@H](O[Si](CC)(CC)C(C)C)[C@H](CC)[C@H](O[Si](CC)(CC)C(C)C)[C@H](C)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C32H64O4Si2/c1-16-22-26(11)29(35-37(18-3,19-4)24(7)8)28(17-2)30(36-38(20-5,21-6)25(9)10)27(12)23-34-31(33)32(13,14)15/h1,24-30H,17-23H2,2-15H3/t26-,27-,28+,29+,30-/m1/s1 |
| InChIKey | QIRIRFGOTIIYIK-IXYVTWBDSA-N |
| XLogP | 9.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.03 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|