C30H62O5Si — CID 158504321
[(3R,4R,5S,6R,9S,10S,12S)-12-[tert-butyl(dimethyl)silyl]oxy-4,10-dimethoxy-3,5,9,13-tetramethyltetradecan-6-yl] 2-methylpropanoate (PubChem CID 158504321) has the molecular formula C30H62O5Si and a molecular weight of 530.91 g/mol. Its IUPAC name is [(3R,4R,5S,6R,9S,10S,12S)-12-[tert-butyl(dimethyl)silyl]oxy-4,10-dimethoxy-3,5,9,13-tetramethyltetradecan-6-yl] 2-methylpropanoate.
| Compound Name | [(3R,4R,5S,6R,9S,10S,12S)-12-[tert-butyl(dimethyl)silyl]oxy-4,10-dimethoxy-3,5,9,13-tetramethyltetradecan-6-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 158504321 |
| Molecular Formula | C30H62O5Si |
| Molecular Weight | 530.91 g/mol |
| Exact Mass | 530.44 |
| IUPAC Name | [(3R,4R,5S,6R,9S,10S,12S)-12-[tert-butyl(dimethyl)silyl]oxy-4,10-dimethoxy-3,5,9,13-tetramethyltetradecan-6-yl] 2-methylpropanoate |
| SMILES | CC[C@@H](C)[C@@H](OC)[C@@H](C)[C@@H](CC[C@H](C)[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)C(C)C)OC)OC(=O)C(C)C |
| InChI | InChI=1S/C30H62O5Si/c1-16-22(6)28(33-13)24(8)25(34-29(31)21(4)5)18-17-23(7)27(32-12)19-26(20(2)3)35-36(14,15)30(9,10)11/h20-28H,16-19H2,1-15H3/t22-,23+,24+,25-,26+,27+,28-/m1/s1 |
| InChIKey | HKHAZOGQEBKIED-TYDZDBEGSA-N |
| XLogP | 8.12 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.91 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|