C24H49IO5Si — CID 10626906
[(3R,4S,5R,7R,8R)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-3,7-dimethoxy-4,8-dimethylnonyl] 2,2-dimethylpropanoate (PubChem CID 10626906) has the molecular formula C24H49IO5Si and a molecular weight of 572.64 g/mol. Its IUPAC name is [(3R,4S,5R,7R,8R)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-3,7-dimethoxy-4,8-dimethylnonyl] 2,2-dimethylpropanoate.
| Compound Name | [(3R,4S,5R,7R,8R)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-3,7-dimethoxy-4,8-dimethylnonyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10626906 |
| Molecular Formula | C24H49IO5Si |
| Molecular Weight | 572.64 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | [(3R,4S,5R,7R,8R)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-3,7-dimethoxy-4,8-dimethylnonyl] 2,2-dimethylpropanoate |
| SMILES | CO[C@H](CCOC(=O)C(C)(C)C)[C@H](C)[C@@H](C[C@@H](OC)[C@@H](C)CI)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H49IO5Si/c1-17(16-25)20(28-10)15-21(30-31(11,12)24(6,7)8)18(2)19(27-9)13-14-29-22(26)23(3,4)5/h17-21H,13-16H2,1-12H3/t17-,18-,19+,20+,21+/m0/s1 |
| InChIKey | LUMZSJCMBIFKGX-WRTQPQOASA-N |
| XLogP | 6.48 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.64 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|