C26H48O5Si — CID 101085214
[(4S)-4-[(2R,4R,5R,6R)-2-methoxy-5-methyl-6-propan-2-yl-4-triethylsilyloxyoxan-2-yl]pent-2-ynyl] 2,2-dimethylpropanoate (PubChem CID 101085214) has the molecular formula C26H48O5Si and a molecular weight of 468.75 g/mol. Its IUPAC name is [(4S)-4-[(2R,4R,5R,6R)-2-methoxy-5-methyl-6-propan-2-yl-4-triethylsilyloxyoxan-2-yl]pent-2-ynyl] 2,2-dimethylpropanoate.
| Compound Name | [(4S)-4-[(2R,4R,5R,6R)-2-methoxy-5-methyl-6-propan-2-yl-4-triethylsilyloxyoxan-2-yl]pent-2-ynyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101085214 |
| Molecular Formula | C26H48O5Si |
| Molecular Weight | 468.75 g/mol |
| Exact Mass | 468.33 |
| IUPAC Name | [(4S)-4-[(2R,4R,5R,6R)-2-methoxy-5-methyl-6-propan-2-yl-4-triethylsilyloxyoxan-2-yl]pent-2-ynyl] 2,2-dimethylpropanoate |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C[C@](OC)([C@@H](C)C#CCOC(=O)C(C)(C)C)O[C@H](C(C)C)[C@H]1C |
| InChI | InChI=1S/C26H48O5Si/c1-12-32(13-2,14-3)31-22-18-26(28-11,30-23(19(4)5)21(22)7)20(6)16-15-17-29-24(27)25(8,9)10/h19-23H,12-14,17-18H2,1-11H3/t20-,21-,22+,23+,26+/m0/s1 |
| InChIKey | BBWHBVIZPMYVHR-NDRZJSJOSA-N |
| XLogP | 6.03 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.75 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|