C24H52O4Si2 — CID 16744719
[(2S,3S,4S,6R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethylheptyl] acetate (PubChem CID 16744719) has the molecular formula C24H52O4Si2 and a molecular weight of 460.85 g/mol. Its IUPAC name is [(2S,3S,4S,6R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethylheptyl] acetate.
| Compound Name | [(2S,3S,4S,6R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethylheptyl] acetate |
|---|---|
| PubChem CID | 16744719 |
| Molecular Formula | C24H52O4Si2 |
| Molecular Weight | 460.85 g/mol |
| Exact Mass | 460.34 |
| IUPAC Name | [(2S,3S,4S,6R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethylheptyl] acetate |
| SMILES | CC(=O)OC[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H52O4Si2/c1-18(16-27-29(11,12)23(5,6)7)15-19(2)22(20(3)17-26-21(4)25)28-30(13,14)24(8,9)10/h18-20,22H,15-17H2,1-14H3/t18-,19+,20+,22+/m1/s1 |
| InChIKey | BNDQZIVCHMBIFY-AQCRLBJHSA-N |
| XLogP | 7.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.85 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|