C29H56O4Si2 — CID 554475
8-[tert-butyl(dimethyl)silyl]oxy-14-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-1-oxacyclotetradec-5-yn-2-one (PubChem CID 554475) has the molecular formula C29H56O4Si2 and a molecular weight of 524.94 g/mol. Its IUPAC name is 8-[tert-butyl(dimethyl)silyl]oxy-14-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-1-oxacyclotetradec-5-yn-2-one.
| Compound Name | 8-[tert-butyl(dimethyl)silyl]oxy-14-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-1-oxacyclotetradec-5-yn-2-one |
|---|---|
| PubChem CID | 554475 |
| Molecular Formula | C29H56O4Si2 |
| Molecular Weight | 524.94 g/mol |
| Exact Mass | 524.37 |
| IUPAC Name | 8-[tert-butyl(dimethyl)silyl]oxy-14-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-1-oxacyclotetradec-5-yn-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCC1CCCCCC(O[Si](C)(C)C(C)(C)C)CC#CCCC(=O)O1 |
| InChI | InChI=1S/C29H56O4Si2/c1-28(2,3)34(7,8)31-24-18-17-20-25-19-13-11-14-21-26(33-35(9,10)29(4,5)6)22-15-12-16-23-27(30)32-25/h25-26H,11,13-14,16-24H2,1-10H3 |
| InChIKey | CWEGCPZIAFZWJN-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.94 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|