C53H92O12Si4 — CID 134969586
[11-acetyloxy-6,6-bis[5-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxypent-3-ynyl]-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]undeca-2,9-diynyl] acetate (PubChem CID 134969586) has the molecular formula C53H92O12Si4 and a molecular weight of 1033.65 g/mol. Its IUPAC name is [11-acetyloxy-6,6-bis[5-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxypent-3-ynyl]-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]undeca-2,9-diynyl] acetate.
| Compound Name | [11-acetyloxy-6,6-bis[5-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxypent-3-ynyl]-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]undeca-2,9-diynyl] acetate |
|---|---|
| PubChem CID | 134969586 |
| Molecular Formula | C53H92O12Si4 |
| Molecular Weight | 1033.65 g/mol |
| Exact Mass | 1032.57 |
| IUPAC Name | [11-acetyloxy-6,6-bis[5-acetyloxy-2-[tert-butyl(dimethyl)silyl]oxypent-3-ynyl]-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]undeca-2,9-diynyl] acetate |
| SMILES | CC(=O)OCC#CC(CC(CC(C#CCOC(C)=O)O[Si](C)(C)C(C)(C)C)(CC(C#CCOC(C)=O)O[Si](C)(C)C(C)(C)C)CC(C#CCOC(C)=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C53H92O12Si4/c1-41(54)58-33-25-29-45(62-66(17,18)49(5,6)7)37-53(38-46(30-26-34-59-42(2)55)63-67(19,20)50(8,9)10,39-47(31-27-35-60-43(3)56)64-68(21,22)51(11,12)13)40-48(32-28-36-61-44(4)57)65-69(23,24)52(14,15)16/h45-48H,33-40H2,1-24H3 |
| InChIKey | BRDGHAFAURQDCV-UHFFFAOYSA-N |
| XLogP | 11.36 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1033.65 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|