C35H35N5O3 — CID 11410564
(E)-3-[2-[1-[(3-cyclopentyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]cyclobutyl]-1-methylbenzimidazol-5-yl]prop-2-enoic acid (PubChem CID 11410564) has the molecular formula C35H35N5O3 and a molecular weight of 573.70 g/mol. Its IUPAC name is (E)-3-[2-[1-[(3-cyclopentyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]cyclobutyl]-1-methylbenzimidazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[1-[(3-cyclopentyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]cyclobutyl]-1-methylbenzimidazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 11410564 |
| Molecular Formula | C35H35N5O3 |
| Molecular Weight | 573.70 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | (E)-3-[2-[1-[(3-cyclopentyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]cyclobutyl]-1-methylbenzimidazol-5-yl]prop-2-enoic acid |
| SMILES | Cn1c(C2(NC(=O)c3ccc4c(C5CCCC5)c(-c5ccccn5)n(C)c4c3)CCC2)nc2cc(/C=C/C(=O)O)ccc21 |
| InChI | InChI=1S/C35H35N5O3/c1-39-29-21-24(13-14-25(29)31(23-8-3-4-9-23)32(39)26-10-5-6-19-36-26)33(43)38-35(17-7-18-35)34-37-27-20-22(12-16-30(41)42)11-15-28(27)40(34)2/h5-6,10-16,19-21,23H,3-4,7-9,17-18H2,1-2H3,(H,38,43)(H,41,42)/b16-12+ |
| InChIKey | GOGTVBULSJSZJV-FOWTUZBSSA-N |
| XLogP | 6.69 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.70 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|