C14H26N2O2 — CID 114105746
N-[(2-ethyloxolan-3-yl)methyl]-4-methylpiperidine-2-carboxamide (PubChem CID 114105746) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is N-[(2-ethyloxolan-3-yl)methyl]-4-methylpiperidine-2-carboxamide.
| Compound Name | N-[(2-ethyloxolan-3-yl)methyl]-4-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 114105746 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | N-[(2-ethyloxolan-3-yl)methyl]-4-methylpiperidine-2-carboxamide |
| SMILES | CCC1OCCC1CNC(=O)C1CC(C)CCN1 |
| InChI | InChI=1S/C14H26N2O2/c1-3-13-11(5-7-18-13)9-16-14(17)12-8-10(2)4-6-15-12/h10-13,15H,3-9H2,1-2H3,(H,16,17) |
| InChIKey | JNHDXLGCPCMGRE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |