C13H19ClN4O2 — CID 114106885
5-chloro-N-[(2-ethyloxolan-3-yl)methyl]-6-hydrazinylpyridine-3-carboxamide (PubChem CID 114106885) has the molecular formula C13H19ClN4O2 and a molecular weight of 298.77 g/mol. Its IUPAC name is 5-chloro-N-[(2-ethyloxolan-3-yl)methyl]-6-hydrazinylpyridine-3-carboxamide.
| Compound Name | 5-chloro-N-[(2-ethyloxolan-3-yl)methyl]-6-hydrazinylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 114106885 |
| Molecular Formula | C13H19ClN4O2 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 5-chloro-N-[(2-ethyloxolan-3-yl)methyl]-6-hydrazinylpyridine-3-carboxamide |
| SMILES | CCC1OCCC1CNC(=O)c1cnc(NN)c(Cl)c1 |
| InChI | InChI=1S/C13H19ClN4O2/c1-2-11-8(3-4-20-11)6-17-13(19)9-5-10(14)12(18-15)16-7-9/h5,7-8,11H,2-4,6,15H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | OZSSCKXQAPRKBV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|