C14H22N2O — CID 114107471
4-N-(2-ethylcyclopropyl)-2-propan-2-yloxybenzene-1,4-diamine (PubChem CID 114107471) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 4-N-(2-ethylcyclopropyl)-2-propan-2-yloxybenzene-1,4-diamine.
| Compound Name | 4-N-(2-ethylcyclopropyl)-2-propan-2-yloxybenzene-1,4-diamine |
|---|---|
| PubChem CID | 114107471 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 4-N-(2-ethylcyclopropyl)-2-propan-2-yloxybenzene-1,4-diamine |
| SMILES | CCC1CC1Nc1ccc(N)c(OC(C)C)c1 |
| InChI | InChI=1S/C14H22N2O/c1-4-10-7-13(10)16-11-5-6-12(15)14(8-11)17-9(2)3/h5-6,8-10,13,16H,4,7,15H2,1-3H3 |
| InChIKey | XKCYJKMNJXSJDZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|