C15H18Cl2N2 — CID 114109116
4-chloro-2-(2-chloroethyl)-1-[(2,2-dimethylcyclopropyl)methyl]benzimidazole (PubChem CID 114109116) has the molecular formula C15H18Cl2N2 and a molecular weight of 297.23 g/mol. Its IUPAC name is 4-chloro-2-(2-chloroethyl)-1-[(2,2-dimethylcyclopropyl)methyl]benzimidazole.
| Compound Name | 4-chloro-2-(2-chloroethyl)-1-[(2,2-dimethylcyclopropyl)methyl]benzimidazole |
|---|---|
| PubChem CID | 114109116 |
| Molecular Formula | C15H18Cl2N2 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 4-chloro-2-(2-chloroethyl)-1-[(2,2-dimethylcyclopropyl)methyl]benzimidazole |
| SMILES | CC1(C)CC1Cn1c(CCCl)nc2c(Cl)cccc21 |
| InChI | InChI=1S/C15H18Cl2N2/c1-15(2)8-10(15)9-19-12-5-3-4-11(17)14(12)18-13(19)6-7-16/h3-5,10H,6-9H2,1-2H3 |
| InChIKey | VVMHCDYBDRAYTA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|