C12H22N6O2 — CID 114110111
4-hydrazinyl-N-(2-methyloxan-4-yl)-6-propoxy-1,3,5-triazin-2-amine (PubChem CID 114110111) has the molecular formula C12H22N6O2 and a molecular weight of 282.35 g/mol. Its IUPAC name is 4-hydrazinyl-N-(2-methyloxan-4-yl)-6-propoxy-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-N-(2-methyloxan-4-yl)-6-propoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 114110111 |
| Molecular Formula | C12H22N6O2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 4-hydrazinyl-N-(2-methyloxan-4-yl)-6-propoxy-1,3,5-triazin-2-amine |
| SMILES | CCCOc1nc(NN)nc(NC2CCOC(C)C2)n1 |
| InChI | InChI=1S/C12H22N6O2/c1-3-5-20-12-16-10(15-11(17-12)18-13)14-9-4-6-19-8(2)7-9/h8-9H,3-7,13H2,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | VJVGZMNKTPBETN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|