C11H15ClN2O3S — CID 114113555
2-chloro-N-(3-methyloxan-3-yl)pyridine-4-sulfonamide (PubChem CID 114113555) has the molecular formula C11H15ClN2O3S and a molecular weight of 290.77 g/mol. Its IUPAC name is 2-chloro-N-(3-methyloxan-3-yl)pyridine-4-sulfonamide.
| Compound Name | 2-chloro-N-(3-methyloxan-3-yl)pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 114113555 |
| Molecular Formula | C11H15ClN2O3S |
| Molecular Weight | 290.77 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 2-chloro-N-(3-methyloxan-3-yl)pyridine-4-sulfonamide |
| SMILES | CC1(NS(=O)(=O)c2ccnc(Cl)c2)CCCOC1 |
| InChI | InChI=1S/C11H15ClN2O3S/c1-11(4-2-6-17-8-11)14-18(15,16)9-3-5-13-10(12)7-9/h3,5,7,14H,2,4,6,8H2,1H3 |
| InChIKey | RWSAGWKCVAUMAS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.77 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|