C12H18BrN3OS — CID 114116816
4-bromo-5-[(1-methylsulfanylcyclopropyl)methylamino]-2-propan-2-ylpyridazin-3-one (PubChem CID 114116816) has the molecular formula C12H18BrN3OS and a molecular weight of 332.27 g/mol. Its IUPAC name is 4-bromo-5-[(1-methylsulfanylcyclopropyl)methylamino]-2-propan-2-ylpyridazin-3-one.
| Compound Name | 4-bromo-5-[(1-methylsulfanylcyclopropyl)methylamino]-2-propan-2-ylpyridazin-3-one |
|---|---|
| PubChem CID | 114116816 |
| Molecular Formula | C12H18BrN3OS |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 4-bromo-5-[(1-methylsulfanylcyclopropyl)methylamino]-2-propan-2-ylpyridazin-3-one |
| SMILES | CSC1(CNc2cnn(C(C)C)c(=O)c2Br)CC1 |
| InChI | InChI=1S/C12H18BrN3OS/c1-8(2)16-11(17)10(13)9(6-15-16)14-7-12(18-3)4-5-12/h6,8,14H,4-5,7H2,1-3H3 |
| InChIKey | KIQYDHOTNLRVSV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |