C14H21BrN2S — CID 114117198
3-bromo-4-methyl-N-[(1-methylsulfanylcyclohexyl)methyl]pyridin-2-amine (PubChem CID 114117198) has the molecular formula C14H21BrN2S and a molecular weight of 329.31 g/mol. Its IUPAC name is 3-bromo-4-methyl-N-[(1-methylsulfanylcyclohexyl)methyl]pyridin-2-amine.
| Compound Name | 3-bromo-4-methyl-N-[(1-methylsulfanylcyclohexyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 114117198 |
| Molecular Formula | C14H21BrN2S |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 3-bromo-4-methyl-N-[(1-methylsulfanylcyclohexyl)methyl]pyridin-2-amine |
| SMILES | CSC1(CNc2nccc(C)c2Br)CCCCC1 |
| InChI | InChI=1S/C14H21BrN2S/c1-11-6-9-16-13(12(11)15)17-10-14(18-2)7-4-3-5-8-14/h6,9H,3-5,7-8,10H2,1-2H3,(H,16,17) |
| InChIKey | NFDCIEAHUQECMV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |