C14H25N3S — CID 114117598
1-(2-ethyl-2-methylsulfanylbutyl)-5-[(2S)-pyrrolidin-2-yl]imidazole (PubChem CID 114117598) has the molecular formula C14H25N3S and a molecular weight of 267.44 g/mol. Its IUPAC name is 1-(2-ethyl-2-methylsulfanylbutyl)-5-[(2S)-pyrrolidin-2-yl]imidazole.
| Compound Name | 1-(2-ethyl-2-methylsulfanylbutyl)-5-[(2S)-pyrrolidin-2-yl]imidazole |
|---|---|
| PubChem CID | 114117598 |
| Molecular Formula | C14H25N3S |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 1-(2-ethyl-2-methylsulfanylbutyl)-5-[(2S)-pyrrolidin-2-yl]imidazole |
| SMILES | CCC(CC)(Cn1cncc1[C@@H]1CCCN1)SC |
| InChI | InChI=1S/C14H25N3S/c1-4-14(5-2,18-3)10-17-11-15-9-13(17)12-7-6-8-16-12/h9,11-12,16H,4-8,10H2,1-3H3/t12-/m0/s1 |
| InChIKey | VXIOGWODRWPVNY-LBPRGKRZSA-N |
| XLogP | 3.23 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |