C15H31NO — CID 114118763
N-(2,6-dimethylheptan-4-yl)-3-ethoxycyclobutan-1-amine (PubChem CID 114118763) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is N-(2,6-dimethylheptan-4-yl)-3-ethoxycyclobutan-1-amine.
| Compound Name | N-(2,6-dimethylheptan-4-yl)-3-ethoxycyclobutan-1-amine |
|---|---|
| PubChem CID | 114118763 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | N-(2,6-dimethylheptan-4-yl)-3-ethoxycyclobutan-1-amine |
| SMILES | CCOC1CC(NC(CC(C)C)CC(C)C)C1 |
| InChI | InChI=1S/C15H31NO/c1-6-17-15-9-14(10-15)16-13(7-11(2)3)8-12(4)5/h11-16H,6-10H2,1-5H3 |
| InChIKey | GCPSUKWPOUTXAU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |