About 1-(2-cyclopropyloxolan-3-yl)-4-ethyl-1,5-diazocane
1-(2-cyclopropyloxolan-3-yl)-4-ethyl-1,5-diazocane (PubChem CID 114120161) has the molecular formula C15H28N2O
and a molecular weight of 252.40 g/mol. Its IUPAC name is 1-(2-cyclopropyloxolan-3-yl)-4-ethyl-1,5-diazocane.
Molecular Properties
| Compound Name | 1-(2-cyclopropyloxolan-3-yl)-4-ethyl-1,5-diazocane |
| PubChem CID | 114120161 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 1-(2-cyclopropyloxolan-3-yl)-4-ethyl-1,5-diazocane |
| SMILES | CCC1CCN(C2CCOC2C2CC2)CCCN1 |
| InChI | InChI=1S/C15H28N2O/c1-2-13-6-10-17(9-3-8-16-13)14-7-11-18-15(14)12-4-5-12/h12-16H,2-11H2,1H3 |
| InChIKey | ZWPDJQNTKOXPLD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-cyclopropyloxolan-3-yl)-4-ethyl-1,5-diazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-cyclopropyloxolan-3-yl)-4-ethyl-1,5-diazocane?
The IUPAC name of 1-(2-cyclopropyloxolan-3-yl)-4-ethyl-1,5-diazocane (CID 114120161) is 1-(2-cyclopropyloxolan-3-yl)-4-ethyl-1,5-diazocane.
What is the SMILES notation for 1-(2-cyclopropyloxolan-3-yl)-4-ethyl-1,5-diazocane?
The canonical SMILES for 1-(2-cyclopropyloxolan-3-yl)-4-ethyl-1,5-diazocane is CCC1CCN(C2CCOC2C2CC2)CCCN1.
What is the InChIKey of 1-(2-cyclopropyloxolan-3-yl)-4-ethyl-1,5-diazocane?
The InChIKey is ZWPDJQNTKOXPLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O/c1-2-13-6-10-17(9-3-8-16-13)14-7-11-18-15(14)12-4-5-12/h12-16H,2-11H2,1H3.
What are the key properties of 1-(2-cyclopropyloxolan-3-yl)-4-ethyl-1,5-diazocane?
1-(2-cyclopropyloxolan-3-yl)-4-ethyl-1,5-diazocane has a molecular weight of 252.40 g/mol, XLogP of 2.02, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-cyclopropyloxolan-3-yl)-4-ethyl-1,5-diazocane is sourced from PubChem (CID 114120161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).