C13H21N3OS — CID 114121209
4-amino-1-ethyl-N-(2-methylsulfanylcyclopentyl)pyrrole-2-carboxamide (PubChem CID 114121209) has the molecular formula C13H21N3OS and a molecular weight of 267.40 g/mol. Its IUPAC name is 4-amino-1-ethyl-N-(2-methylsulfanylcyclopentyl)pyrrole-2-carboxamide.
| Compound Name | 4-amino-1-ethyl-N-(2-methylsulfanylcyclopentyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 114121209 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 4-amino-1-ethyl-N-(2-methylsulfanylcyclopentyl)pyrrole-2-carboxamide |
| SMILES | CCn1cc(N)cc1C(=O)NC1CCCC1SC |
| InChI | InChI=1S/C13H21N3OS/c1-3-16-8-9(14)7-11(16)13(17)15-10-5-4-6-12(10)18-2/h7-8,10,12H,3-6,14H2,1-2H3,(H,15,17) |
| InChIKey | QQNAKAHCCOHMAJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |