C13H26N2OS — CID 114121621
N-(3-methylbutyl)-2-[(2-methylsulfanylcyclopentyl)amino]acetamide (PubChem CID 114121621) has the molecular formula C13H26N2OS and a molecular weight of 258.43 g/mol. Its IUPAC name is N-(3-methylbutyl)-2-[(2-methylsulfanylcyclopentyl)amino]acetamide.
| Compound Name | N-(3-methylbutyl)-2-[(2-methylsulfanylcyclopentyl)amino]acetamide |
|---|---|
| PubChem CID | 114121621 |
| Molecular Formula | C13H26N2OS |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | N-(3-methylbutyl)-2-[(2-methylsulfanylcyclopentyl)amino]acetamide |
| SMILES | CSC1CCCC1NCC(=O)NCCC(C)C |
| InChI | InChI=1S/C13H26N2OS/c1-10(2)7-8-14-13(16)9-15-11-5-4-6-12(11)17-3/h10-12,15H,4-9H2,1-3H3,(H,14,16) |
| InChIKey | BBSVNRRTGOVQFK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |