C14H21BrN2S — CID 114122467
2-bromo-5-methyl-1-N-(4-methylsulfanylcyclohexyl)benzene-1,4-diamine (PubChem CID 114122467) has the molecular formula C14H21BrN2S and a molecular weight of 329.31 g/mol. Its IUPAC name is 2-bromo-5-methyl-1-N-(4-methylsulfanylcyclohexyl)benzene-1,4-diamine.
| Compound Name | 2-bromo-5-methyl-1-N-(4-methylsulfanylcyclohexyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 114122467 |
| Molecular Formula | C14H21BrN2S |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 2-bromo-5-methyl-1-N-(4-methylsulfanylcyclohexyl)benzene-1,4-diamine |
| SMILES | CSC1CCC(Nc2cc(C)c(N)cc2Br)CC1 |
| InChI | InChI=1S/C14H21BrN2S/c1-9-7-14(12(15)8-13(9)16)17-10-3-5-11(18-2)6-4-10/h7-8,10-11,17H,3-6,16H2,1-2H3 |
| InChIKey | RCIPNAJLIGIYRA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|