C15H30N2S — CID 114122783
1-(3-methylsulfanylcyclohexyl)-3-propyl-1,4-diazepane (PubChem CID 114122783) has the molecular formula C15H30N2S and a molecular weight of 270.49 g/mol. Its IUPAC name is 1-(3-methylsulfanylcyclohexyl)-3-propyl-1,4-diazepane.
| Compound Name | 1-(3-methylsulfanylcyclohexyl)-3-propyl-1,4-diazepane |
|---|---|
| PubChem CID | 114122783 |
| Molecular Formula | C15H30N2S |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 1-(3-methylsulfanylcyclohexyl)-3-propyl-1,4-diazepane |
| SMILES | CCCC1CN(C2CCCC(SC)C2)CCCN1 |
| InChI | InChI=1S/C15H30N2S/c1-3-6-13-12-17(10-5-9-16-13)14-7-4-8-15(11-14)18-2/h13-16H,3-12H2,1-2H3 |
| InChIKey | YCYYXIMDJCQKOI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |