C14H22ClN3S — CID 114123821
6-chloro-5-methyl-N-(3-methylsulfanylcyclopentyl)-2-propan-2-ylpyrimidin-4-amine (PubChem CID 114123821) has the molecular formula C14H22ClN3S and a molecular weight of 299.87 g/mol. Its IUPAC name is 6-chloro-5-methyl-N-(3-methylsulfanylcyclopentyl)-2-propan-2-ylpyrimidin-4-amine.
| Compound Name | 6-chloro-5-methyl-N-(3-methylsulfanylcyclopentyl)-2-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 114123821 |
| Molecular Formula | C14H22ClN3S |
| Molecular Weight | 299.87 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 6-chloro-5-methyl-N-(3-methylsulfanylcyclopentyl)-2-propan-2-ylpyrimidin-4-amine |
| SMILES | CSC1CCC(Nc2nc(C(C)C)nc(Cl)c2C)C1 |
| InChI | InChI=1S/C14H22ClN3S/c1-8(2)13-17-12(15)9(3)14(18-13)16-10-5-6-11(7-10)19-4/h8,10-11H,5-7H2,1-4H3,(H,16,17,18) |
| InChIKey | KWQZBNMPAKCANK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.87 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |