C13H15BrN2S2 — CID 114124197
5-bromo-N-(3-methylsulfanylcyclopentyl)-1,3-benzothiazol-2-amine (PubChem CID 114124197) has the molecular formula C13H15BrN2S2 and a molecular weight of 343.32 g/mol. Its IUPAC name is 5-bromo-N-(3-methylsulfanylcyclopentyl)-1,3-benzothiazol-2-amine.
| Compound Name | 5-bromo-N-(3-methylsulfanylcyclopentyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 114124197 |
| Molecular Formula | C13H15BrN2S2 |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 5-bromo-N-(3-methylsulfanylcyclopentyl)-1,3-benzothiazol-2-amine |
| SMILES | CSC1CCC(Nc2nc3cc(Br)ccc3s2)C1 |
| InChI | InChI=1S/C13H15BrN2S2/c1-17-10-4-3-9(7-10)15-13-16-11-6-8(14)2-5-12(11)18-13/h2,5-6,9-10H,3-4,7H2,1H3,(H,15,16) |
| InChIKey | MGTAQKVIDDEDKG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |