C9H17NO2 — CID 11412640
(7S,8R,8aS)-8-methyl-2,3,5,6,7,8a-hexahydro-1H-indolizine-7,8-diol (PubChem CID 11412640) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is (7S,8R,8aS)-8-methyl-2,3,5,6,7,8a-hexahydro-1H-indolizine-7,8-diol.
| Compound Name | (7S,8R,8aS)-8-methyl-2,3,5,6,7,8a-hexahydro-1H-indolizine-7,8-diol |
|---|---|
| PubChem CID | 11412640 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (7S,8R,8aS)-8-methyl-2,3,5,6,7,8a-hexahydro-1H-indolizine-7,8-diol |
| SMILES | C[C@@]1(O)[C@@H]2CCCN2CC[C@@H]1O |
| InChI | InChI=1S/C9H17NO2/c1-9(12)7-3-2-5-10(7)6-4-8(9)11/h7-8,11-12H,2-6H2,1H3/t7-,8-,9+/m0/s1 |
| InChIKey | ASLQTEMVKGWSDF-XHNCKOQMSA-N |
| XLogP | -0.03 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |