C12H24F2N2O2 — CID 114127414
2-(aminomethyl)-N-[2-(2,2-difluoroethoxy)ethyl]-4,4-dimethylpentanamide (PubChem CID 114127414) has the molecular formula C12H24F2N2O2 and a molecular weight of 266.33 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[2-(2,2-difluoroethoxy)ethyl]-4,4-dimethylpentanamide.
| Compound Name | 2-(aminomethyl)-N-[2-(2,2-difluoroethoxy)ethyl]-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 114127414 |
| Molecular Formula | C12H24F2N2O2 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 2-(aminomethyl)-N-[2-(2,2-difluoroethoxy)ethyl]-4,4-dimethylpentanamide |
| SMILES | CC(C)(C)CC(CN)C(=O)NCCOCC(F)F |
| InChI | InChI=1S/C12H24F2N2O2/c1-12(2,3)6-9(7-15)11(17)16-4-5-18-8-10(13)14/h9-10H,4-8,15H2,1-3H3,(H,16,17) |
| InChIKey | CWYMHZVZCSIJEI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|