C10H19F2N3O2 — CID 114127896
2-[1-[[2-(2,2-difluoroethoxy)ethylamino]methyl]cyclopropyl]-N'-hydroxyethanimidamide (PubChem CID 114127896) has the molecular formula C10H19F2N3O2 and a molecular weight of 251.28 g/mol. Its IUPAC name is 2-[1-[[2-(2,2-difluoroethoxy)ethylamino]methyl]cyclopropyl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[1-[[2-(2,2-difluoroethoxy)ethylamino]methyl]cyclopropyl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 114127896 |
| Molecular Formula | C10H19F2N3O2 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 2-[1-[[2-(2,2-difluoroethoxy)ethylamino]methyl]cyclopropyl]-N'-hydroxyethanimidamide |
| SMILES | NC(CC1(CNCCOCC(F)F)CC1)=NO |
| InChI | InChI=1S/C10H19F2N3O2/c11-8(12)6-17-4-3-14-7-10(1-2-10)5-9(13)15-16/h8,14,16H,1-7H2,(H2,13,15) |
| InChIKey | XDMQWZPAKBBNLS-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|