C9H17F2N3O2 — CID 106177195
2-[1-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]cyclopropyl]-N'-hydroxyethanimidamide (PubChem CID 106177195) has the molecular formula C9H17F2N3O2 and a molecular weight of 237.25 g/mol. Its IUPAC name is 2-[1-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]cyclopropyl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[1-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]cyclopropyl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 106177195 |
| Molecular Formula | C9H17F2N3O2 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 2-[1-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]cyclopropyl]-N'-hydroxyethanimidamide |
| SMILES | NC(CC1(CNCC(F)(F)CO)CC1)=NO |
| InChI | InChI=1S/C9H17F2N3O2/c10-9(11,6-15)5-13-4-8(1-2-8)3-7(12)14-16/h13,15-16H,1-6H2,(H2,12,14) |
| InChIKey | HYFOWVQWWFXROX-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|