C9H19F2N3O2 — CID 106177198
4-[(2,2-difluoro-3-hydroxypropyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide (PubChem CID 106177198) has the molecular formula C9H19F2N3O2 and a molecular weight of 239.27 g/mol. Its IUPAC name is 4-[(2,2-difluoro-3-hydroxypropyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide.
| Compound Name | 4-[(2,2-difluoro-3-hydroxypropyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 106177198 |
| Molecular Formula | C9H19F2N3O2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 4-[(2,2-difluoro-3-hydroxypropyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide |
| SMILES | CC(C)(CCNCC(F)(F)CO)C(N)=NO |
| InChI | InChI=1S/C9H19F2N3O2/c1-8(2,7(12)14-16)3-4-13-5-9(10,11)6-15/h13,15-16H,3-6H2,1-2H3,(H2,12,14) |
| InChIKey | XCEAEFXPKACEMH-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|