C11H23F2N3O2 — CID 106177189
6-[(2,2-difluoro-3-hydroxypropyl)amino]-N'-hydroxy-2,2-dimethylhexanimidamide (PubChem CID 106177189) has the molecular formula C11H23F2N3O2 and a molecular weight of 267.32 g/mol. Its IUPAC name is 6-[(2,2-difluoro-3-hydroxypropyl)amino]-N'-hydroxy-2,2-dimethylhexanimidamide.
| Compound Name | 6-[(2,2-difluoro-3-hydroxypropyl)amino]-N'-hydroxy-2,2-dimethylhexanimidamide |
|---|---|
| PubChem CID | 106177189 |
| Molecular Formula | C11H23F2N3O2 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 6-[(2,2-difluoro-3-hydroxypropyl)amino]-N'-hydroxy-2,2-dimethylhexanimidamide |
| SMILES | CC(C)(CCCCNCC(F)(F)CO)C(N)=NO |
| InChI | InChI=1S/C11H23F2N3O2/c1-10(2,9(14)16-18)5-3-4-6-15-7-11(12,13)8-17/h15,17-18H,3-8H2,1-2H3,(H2,14,16) |
| InChIKey | UDQUXLKISMWKOT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|